1-(4-PROPOXY-PHENYL)-ETHANONE
Catalog No: FT-0635828
CAS No: 5736-86-7
- Chemical Name: 1-(4-PROPOXY-PHENYL)-ETHANONE
- Molecular Formula: C11H14O2
- Molecular Weight: 178.23
- InChI Key: RTYYKCQJSTZADZ-UHFFFAOYSA-N
- InChI: InChI=1S/C11H14O2/c1-3-8-13-11-6-4-10(5-7-11)9(2)12/h4-7H,3,8H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 5736-86-7 |
| Flash_Point: | 124.3ºC |
| Product_Name: | 1-(4-Propoxyphenyl)ethanone |
| Bolling_Point: | 288.3ºC at 760mmHg |
| FW: | 178.22800 |
| Melting_Point: | N/A |
| MF: | C11H14O2 |
| Density: | 1.001g/cm3 |
| Refractive_Index: | 1.498 |
|---|---|
| MF: | C11H14O2 |
| Flash_Point: | 124.3ºC |
| LogP: | 2.67800 |
| FW: | 178.22800 |
| Density: | 1.001g/cm3 |
| PSA: | 26.30000 |
| Bolling_Point: | 288.3ºC at 760mmHg |
| Exact_Mass: | 178.09900 |
| Symbol: | GHS07 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| HS_Code: | 2914509090 |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)